C18H26N2O4S — CID 134059774
N-cyclopentyl-N-ethyl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 134059774) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is N-cyclopentyl-N-ethyl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-cyclopentyl-N-ethyl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 134059774 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N-cyclopentyl-N-ethyl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCN(C(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1)C1CCCC1 |
| InChI | InChI=1S/C18H26N2O4S/c1-2-20(16-7-3-4-8-16)18(21)15-6-5-9-17(14-15)25(22,23)19-10-12-24-13-11-19/h5-6,9,14,16H,2-4,7-8,10-13H2,1H3 |
| InChIKey | OMMQNHOKHUYCQN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |