C21H32N2O3S — CID 36553254
3-(azepan-1-ylsulfonyl)-N-(cyclohexylmethyl)-N-methylbenzamide (PubChem CID 36553254) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)-N-(cyclohexylmethyl)-N-methylbenzamide.
| Compound Name | 3-(azepan-1-ylsulfonyl)-N-(cyclohexylmethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 36553254 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)-N-(cyclohexylmethyl)-N-methylbenzamide |
| SMILES | CN(CC1CCCCC1)C(=O)c1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C21H32N2O3S/c1-22(17-18-10-5-4-6-11-18)21(24)19-12-9-13-20(16-19)27(25,26)23-14-7-2-3-8-15-23/h9,12-13,16,18H,2-8,10-11,14-15,17H2,1H3 |
| InChIKey | FFZACYMLZNMRPA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |