C19H26Cl2N2O4S — CID 55468764
2,4-dichloro-N-cycloheptyl-N-methyl-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 55468764) has the molecular formula C19H26Cl2N2O4S and a molecular weight of 449.40 g/mol. Its IUPAC name is 2,4-dichloro-N-cycloheptyl-N-methyl-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 2,4-dichloro-N-cycloheptyl-N-methyl-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55468764 |
| Molecular Formula | C19H26Cl2N2O4S |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 2,4-dichloro-N-cycloheptyl-N-methyl-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | CN(C(=O)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl)C1CCCCCC1 |
| InChI | InChI=1S/C19H26Cl2N2O4S/c1-22(14-6-4-2-3-5-7-14)19(24)15-12-18(17(21)13-16(15)20)28(25,26)23-8-10-27-11-9-23/h12-14H,2-11H2,1H3 |
| InChIKey | HXJLTMMEPLWMRO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |