C18H28N2O3S — CID 32916846
5-(ethylsulfamoyl)-N,2-dimethyl-N-(4-methylcyclohexyl)benzamide (PubChem CID 32916846) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is 5-(ethylsulfamoyl)-N,2-dimethyl-N-(4-methylcyclohexyl)benzamide.
| Compound Name | 5-(ethylsulfamoyl)-N,2-dimethyl-N-(4-methylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 32916846 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 5-(ethylsulfamoyl)-N,2-dimethyl-N-(4-methylcyclohexyl)benzamide |
| SMILES | CCNS(=O)(=O)c1ccc(C)c(C(=O)N(C)C2CCC(C)CC2)c1 |
| InChI | InChI=1S/C18H28N2O3S/c1-5-19-24(22,23)16-11-8-14(3)17(12-16)18(21)20(4)15-9-6-13(2)7-10-15/h8,11-13,15,19H,5-7,9-10H2,1-4H3 |
| InChIKey | XVCUBZJQFQGWBH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |