C21H32N2O3S — CID 55372562
N,2-dimethyl-N-(4-methylcyclohexyl)-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 55372562) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is N,2-dimethyl-N-(4-methylcyclohexyl)-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N,2-dimethyl-N-(4-methylcyclohexyl)-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55372562 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N,2-dimethyl-N-(4-methylcyclohexyl)-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)N(C)C1CCC(C)CC1 |
| InChI | InChI=1S/C21H32N2O3S/c1-16-7-10-18(11-8-16)22(3)21(24)20-15-19(12-9-17(20)2)27(25,26)23-13-5-4-6-14-23/h9,12,15-16,18H,4-8,10-11,13-14H2,1-3H3 |
| InChIKey | HXPJEJRKGMHFCU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |