C22H28N2O3S — CID 43021987
N,2-dimethyl-N-(1-phenylethyl)-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 43021987) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is N,2-dimethyl-N-(1-phenylethyl)-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N,2-dimethyl-N-(1-phenylethyl)-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 43021987 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N,2-dimethyl-N-(1-phenylethyl)-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)N(C)C(C)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O3S/c1-17-12-13-20(28(26,27)24-14-8-5-9-15-24)16-21(17)22(25)23(3)18(2)19-10-6-4-7-11-19/h4,6-7,10-13,16,18H,5,8-9,14-15H2,1-3H3 |
| InChIKey | GPVOUGZEHVDORP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |