C17H23NO6S — CID 55449133
2-(4-morpholin-4-ylsulfonylphenoxy)ethyl cyclobutanecarboxylate (PubChem CID 55449133) has the molecular formula C17H23NO6S and a molecular weight of 369.44 g/mol. Its IUPAC name is 2-(4-morpholin-4-ylsulfonylphenoxy)ethyl cyclobutanecarboxylate.
| Compound Name | 2-(4-morpholin-4-ylsulfonylphenoxy)ethyl cyclobutanecarboxylate |
|---|---|
| PubChem CID | 55449133 |
| Molecular Formula | C17H23NO6S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-(4-morpholin-4-ylsulfonylphenoxy)ethyl cyclobutanecarboxylate |
| SMILES | O=C(OCCOc1ccc(S(=O)(=O)N2CCOCC2)cc1)C1CCC1 |
| InChI | InChI=1S/C17H23NO6S/c19-17(14-2-1-3-14)24-13-12-23-15-4-6-16(7-5-15)25(20,21)18-8-10-22-11-9-18/h4-7,14H,1-3,8-13H2 |
| InChIKey | HYRVGPLFBQYPMJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|