C20H24FN4O4S+ — CID 3675075
N-(4-acetamidophenyl)-2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 3675075) has the molecular formula C20H24FN4O4S+ and a molecular weight of 435.50 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(4-acetamidophenyl)-2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 3675075 |
| Molecular Formula | C20H24FN4O4S+ |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | N-(4-acetamidophenyl)-2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C[NH+]2CCN(S(=O)(=O)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H23FN4O4S/c1-15(26)22-17-4-6-18(7-5-17)23-20(27)14-24-10-12-25(13-11-24)30(28,29)19-8-2-16(21)3-9-19/h2-9H,10-14H2,1H3,(H,22,26)(H,23,27)/p+1 |
| InChIKey | JNWFFNDKDZNXTF-UHFFFAOYSA-O |
| XLogP | 0.31 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |