C18H21IN3O3S+ — CID 2399038
2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-(4-iodophenyl)acetamide (PubChem CID 2399038) has the molecular formula C18H21IN3O3S+ and a molecular weight of 486.36 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 2399038 |
| Molecular Formula | C18H21IN3O3S+ |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | 2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-(4-iodophenyl)acetamide |
| SMILES | O=C(C[NH+]1CCN(S(=O)(=O)c2ccccc2)CC1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C18H20IN3O3S/c19-15-6-8-16(9-7-15)20-18(23)14-21-10-12-22(13-11-21)26(24,25)17-4-2-1-3-5-17/h1-9H,10-14H2,(H,20,23)/p+1 |
| InChIKey | YKVLYVCEFOYYSV-UHFFFAOYSA-O |
| XLogP | 0.82 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|