C16H24FN2O4S+ — CID 8688171
tert-butyl 2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]acetate (PubChem CID 8688171) has the molecular formula C16H24FN2O4S+ and a molecular weight of 359.44 g/mol. Its IUPAC name is tert-butyl 2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 8688171 |
| Molecular Formula | C16H24FN2O4S+ |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | tert-butyl 2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[NH+]1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H23FN2O4S/c1-16(2,3)23-15(20)12-18-8-10-19(11-9-18)24(21,22)14-6-4-13(17)5-7-14/h4-7H,8-12H2,1-3H3/p+1 |
| InChIKey | CLLPCOOCGAWMDJ-UHFFFAOYSA-O |
| XLogP | 0.06 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |