C19H27FN3O3S+ — CID 8688659
N-(3-ethylpent-1-yn-3-yl)-2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 8688659) has the molecular formula C19H27FN3O3S+ and a molecular weight of 396.51 g/mol. Its IUPAC name is N-(3-ethylpent-1-yn-3-yl)-2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(3-ethylpent-1-yn-3-yl)-2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8688659 |
| Molecular Formula | C19H27FN3O3S+ |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-(3-ethylpent-1-yn-3-yl)-2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | C#CC(CC)(CC)NC(=O)C[NH+]1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H26FN3O3S/c1-4-19(5-2,6-3)21-18(24)15-22-11-13-23(14-12-22)27(25,26)17-9-7-16(20)8-10-17/h1,7-10H,5-6,11-15H2,2-3H3,(H,21,24)/p+1 |
| InChIKey | PSFYLKAQMYKNNU-UHFFFAOYSA-O |
| XLogP | 0.02 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|