C19H26N2O3S — CID 8839640
N-(3-ethylpent-1-yn-3-yl)-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 8839640) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is N-(3-ethylpent-1-yn-3-yl)-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(3-ethylpent-1-yn-3-yl)-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 8839640 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | N-(3-ethylpent-1-yn-3-yl)-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | C#CC(CC)(CC)NC(=O)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H26N2O3S/c1-4-19(5-2,6-3)20-18(22)16-10-12-17(13-11-16)25(23,24)21-14-8-7-9-15-21/h1,10-13H,5-9,14-15H2,2-3H3,(H,20,22) |
| InChIKey | UIUWWQGGVRLCOS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|