C14H19FN3O2S+ — CID 8688304
(2S)-3-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-2-methylpropanenitrile (PubChem CID 8688304) has the molecular formula C14H19FN3O2S+ and a molecular weight of 312.39 g/mol. Its IUPAC name is (2S)-3-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-2-methylpropanenitrile.
| Compound Name | (2S)-3-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 8688304 |
| Molecular Formula | C14H19FN3O2S+ |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (2S)-3-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-2-methylpropanenitrile |
| SMILES | C[C@H](C#N)C[NH+]1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C14H18FN3O2S/c1-12(10-16)11-17-6-8-18(9-7-17)21(19,20)14-4-2-13(15)3-5-14/h2-5,12H,6-9,11H2,1H3/p+1/t12-/m1/s1 |
| InChIKey | NFCOYGIASQQWAR-GFCCVEGCSA-O |
| XLogP | -0.13 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |