C12H17BrN3O2S2+ — CID 8685016
(2R)-3-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-ium-1-yl]-2-methylpropanenitrile (PubChem CID 8685016) has the molecular formula C12H17BrN3O2S2+ and a molecular weight of 379.33 g/mol. Its IUPAC name is (2R)-3-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-ium-1-yl]-2-methylpropanenitrile.
| Compound Name | (2R)-3-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-ium-1-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 8685016 |
| Molecular Formula | C12H17BrN3O2S2+ |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | (2R)-3-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-ium-1-yl]-2-methylpropanenitrile |
| SMILES | C[C@@H](C#N)C[NH+]1CCN(S(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C12H16BrN3O2S2/c1-10(8-14)9-15-4-6-16(7-5-15)20(17,18)12-3-2-11(13)19-12/h2-3,10H,4-7,9H2,1H3/p+1/t10-/m0/s1 |
| InChIKey | WZWGDMZCYLQSHK-JTQLQIEISA-O |
| XLogP | 0.56 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |