C16H19BrN2O2S2 — CID 39903994
1-(5-bromothiophen-2-yl)sulfonyl-4-[(1S)-1-phenylethyl]piperazine (PubChem CID 39903994) has the molecular formula C16H19BrN2O2S2 and a molecular weight of 415.38 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)sulfonyl-4-[(1S)-1-phenylethyl]piperazine.
| Compound Name | 1-(5-bromothiophen-2-yl)sulfonyl-4-[(1S)-1-phenylethyl]piperazine |
|---|---|
| PubChem CID | 39903994 |
| Molecular Formula | C16H19BrN2O2S2 |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)sulfonyl-4-[(1S)-1-phenylethyl]piperazine |
| SMILES | C[C@@H](c1ccccc1)N1CCN(S(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C16H19BrN2O2S2/c1-13(14-5-3-2-4-6-14)18-9-11-19(12-10-18)23(20,21)16-8-7-15(17)22-16/h2-8,13H,9-12H2,1H3/t13-/m0/s1 |
| InChIKey | SCTYNRKBRUGZJB-ZDUSSCGKSA-N |
| XLogP | 3.58 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |