C17H18BrClN2O4S2 — CID 55508704
methyl 2-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-2-(2-chlorophenyl)acetate (PubChem CID 55508704) has the molecular formula C17H18BrClN2O4S2 and a molecular weight of 493.83 g/mol. Its IUPAC name is methyl 2-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-2-(2-chlorophenyl)acetate.
| Compound Name | methyl 2-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-2-(2-chlorophenyl)acetate |
|---|---|
| PubChem CID | 55508704 |
| Molecular Formula | C17H18BrClN2O4S2 |
| Molecular Weight | 493.83 g/mol |
| Exact Mass | 491.96 |
| IUPAC Name | methyl 2-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-2-(2-chlorophenyl)acetate |
| SMILES | COC(=O)C(c1ccccc1Cl)N1CCN(S(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C17H18BrClN2O4S2/c1-25-17(22)16(12-4-2-3-5-13(12)19)20-8-10-21(11-9-20)27(23,24)15-7-6-14(18)26-15/h2-7,16H,8-11H2,1H3 |
| InChIKey | IGMDHYUXUBWBQB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.83 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |