C14H19Cl2NO2S — CID 23000853
methyl 2-(2-chlorophenyl)-2-(4-sulfanylpiperidin-1-yl)acetate;hydrochloride (PubChem CID 23000853) has the molecular formula C14H19Cl2NO2S and a molecular weight of 336.28 g/mol. Its IUPAC name is methyl 2-(2-chlorophenyl)-2-(4-sulfanylpiperidin-1-yl)acetate;hydrochloride.
| Compound Name | methyl 2-(2-chlorophenyl)-2-(4-sulfanylpiperidin-1-yl)acetate;hydrochloride |
|---|---|
| PubChem CID | 23000853 |
| Molecular Formula | C14H19Cl2NO2S |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | methyl 2-(2-chlorophenyl)-2-(4-sulfanylpiperidin-1-yl)acetate;hydrochloride |
| SMILES | COC(=O)C(c1ccccc1Cl)N1CCC(S)CC1.Cl |
| InChI | InChI=1S/C14H18ClNO2S.ClH/c1-18-14(17)13(11-4-2-3-5-12(11)15)16-8-6-10(19)7-9-16;/h2-5,10,13,19H,6-9H2,1H3;1H |
| InChIKey | OCUKIRHXHKSPMR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|