C17H20ClNO3S — CID 129157138
methyl (2S)-2-(2-chlorophenyl)-2-[(3Z)-3-(2-oxopropylidene)-4-sulfanylpiperidin-1-yl]acetate (PubChem CID 129157138) has the molecular formula C17H20ClNO3S and a molecular weight of 353.87 g/mol. Its IUPAC name is methyl (2S)-2-(2-chlorophenyl)-2-[(3Z)-3-(2-oxopropylidene)-4-sulfanylpiperidin-1-yl]acetate.
| Compound Name | methyl (2S)-2-(2-chlorophenyl)-2-[(3Z)-3-(2-oxopropylidene)-4-sulfanylpiperidin-1-yl]acetate |
|---|---|
| PubChem CID | 129157138 |
| Molecular Formula | C17H20ClNO3S |
| Molecular Weight | 353.87 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | methyl (2S)-2-(2-chlorophenyl)-2-[(3Z)-3-(2-oxopropylidene)-4-sulfanylpiperidin-1-yl]acetate |
| SMILES | COC(=O)[C@H](c1ccccc1Cl)N1CCC(S)/C(=C\C(C)=O)C1 |
| InChI | InChI=1S/C17H20ClNO3S/c1-11(20)9-12-10-19(8-7-15(12)23)16(17(21)22-2)13-5-3-4-6-14(13)18/h3-6,9,15-16,23H,7-8,10H2,1-2H3/b12-9-/t15?,16-/m0/s1 |
| InChIKey | KBDXZRNUKHLKCU-UAGKUDHASA-N |
| XLogP | 3.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.87 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|