C16H18ClNO4 — CID 144607080
(2E)-2-[1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]piperidin-3-ylidene]acetic acid (PubChem CID 144607080) has the molecular formula C16H18ClNO4 and a molecular weight of 323.78 g/mol. Its IUPAC name is (2E)-2-[1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]piperidin-3-ylidene]acetic acid.
| Compound Name | (2E)-2-[1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]piperidin-3-ylidene]acetic acid |
|---|---|
| PubChem CID | 144607080 |
| Molecular Formula | C16H18ClNO4 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | (2E)-2-[1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]piperidin-3-ylidene]acetic acid |
| SMILES | COC(=O)[C@H](c1ccccc1Cl)N1CCC/C(=C\C(=O)O)C1 |
| InChI | InChI=1S/C16H18ClNO4/c1-22-16(21)15(12-6-2-3-7-13(12)17)18-8-4-5-11(10-18)9-14(19)20/h2-3,6-7,9,15H,4-5,8,10H2,1H3,(H,19,20)/b11-9+/t15-/m0/s1 |
| InChIKey | LTBPQLNXSKARDN-GDXASINISA-N |
| XLogP | 2.66 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|