C23H22ClNO5S — CID 169069103
(2E)-2-[4-benzoylsulfanyl-1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]piperidin-3-ylidene]acetic acid (PubChem CID 169069103) has the molecular formula C23H22ClNO5S and a molecular weight of 459.95 g/mol. Its IUPAC name is (2E)-2-[4-benzoylsulfanyl-1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]piperidin-3-ylidene]acetic acid.
| Compound Name | (2E)-2-[4-benzoylsulfanyl-1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]piperidin-3-ylidene]acetic acid |
|---|---|
| PubChem CID | 169069103 |
| Molecular Formula | C23H22ClNO5S |
| Molecular Weight | 459.95 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | (2E)-2-[4-benzoylsulfanyl-1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]piperidin-3-ylidene]acetic acid |
| SMILES | COC(=O)[C@H](c1ccccc1Cl)N1CCC(SC(=O)c2ccccc2)/C(=C/C(=O)O)C1 |
| InChI | InChI=1S/C23H22ClNO5S/c1-30-22(28)21(17-9-5-6-10-18(17)24)25-12-11-19(16(14-25)13-20(26)27)31-23(29)15-7-3-2-4-8-15/h2-10,13,19,21H,11-12,14H2,1H3,(H,26,27)/b16-13+/t19?,21-/m0/s1 |
| InChIKey | BMCFAJBFEBIRHR-GNEKCUEESA-N |
| XLogP | 4.21 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.95 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|