C18H23FN2O4S2 — CID 118565531
(2Z)-2-[4-(2-aminoethyldisulfanyl)-1-[1-(2-fluorophenyl)-2-methoxy-2-oxoethyl]piperidin-3-ylidene]acetic acid (PubChem CID 118565531) has the molecular formula C18H23FN2O4S2 and a molecular weight of 414.52 g/mol. Its IUPAC name is (2Z)-2-[4-(2-aminoethyldisulfanyl)-1-[1-(2-fluorophenyl)-2-methoxy-2-oxoethyl]piperidin-3-ylidene]acetic acid.
| Compound Name | (2Z)-2-[4-(2-aminoethyldisulfanyl)-1-[1-(2-fluorophenyl)-2-methoxy-2-oxoethyl]piperidin-3-ylidene]acetic acid |
|---|---|
| PubChem CID | 118565531 |
| Molecular Formula | C18H23FN2O4S2 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | (2Z)-2-[4-(2-aminoethyldisulfanyl)-1-[1-(2-fluorophenyl)-2-methoxy-2-oxoethyl]piperidin-3-ylidene]acetic acid |
| SMILES | COC(=O)C(c1ccccc1F)N1CCC(SSCCN)/C(=C\C(=O)O)C1 |
| InChI | InChI=1S/C18H23FN2O4S2/c1-25-18(24)17(13-4-2-3-5-14(13)19)21-8-6-15(27-26-9-7-20)12(11-21)10-16(22)23/h2-5,10,15,17H,6-9,11,20H2,1H3,(H,22,23)/b12-10- |
| InChIKey | DTMJOUVUOSGCEX-BENRWUELSA-N |
| XLogP | 2.47 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|