C21H26ClNO7S — CID 170224352
(2Z)-2-[(4S)-1-[1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]-4-(propan-2-yloxycarbonyloxymethylsulfanyl)piperidin-3-ylidene]acetic acid (PubChem CID 170224352) has the molecular formula C21H26ClNO7S and a molecular weight of 471.96 g/mol. Its IUPAC name is (2Z)-2-[(4S)-1-[1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]-4-(propan-2-yloxycarbonyloxymethylsulfanyl)piperidin-3-ylidene]acetic acid.
| Compound Name | (2Z)-2-[(4S)-1-[1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]-4-(propan-2-yloxycarbonyloxymethylsulfanyl)piperidin-3-ylidene]acetic acid |
|---|---|
| PubChem CID | 170224352 |
| Molecular Formula | C21H26ClNO7S |
| Molecular Weight | 471.96 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | (2Z)-2-[(4S)-1-[1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]-4-(propan-2-yloxycarbonyloxymethylsulfanyl)piperidin-3-ylidene]acetic acid |
| SMILES | COC(=O)C(c1ccccc1Cl)N1CC[C@H](SCOC(=O)OC(C)C)/C(=C\C(=O)O)C1 |
| InChI | InChI=1S/C21H26ClNO7S/c1-13(2)30-21(27)29-12-31-17-8-9-23(11-14(17)10-18(24)25)19(20(26)28-3)15-6-4-5-7-16(15)22/h4-7,10,13,17,19H,8-9,11-12H2,1-3H3,(H,24,25)/b14-10-/t17-,19?/m0/s1 |
| InChIKey | JIHSKBXKKCQDED-IAIFLBROSA-N |
| XLogP | 3.89 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.96 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|