C25H28ClNO6S2 — CID 54496719
methyl 2-(2-chlorophenyl)-2-[3-(2-ethoxy-2-oxoethylidene)-4-(4-methylphenyl)sulfonylsulfanylpiperidin-1-yl]acetate (PubChem CID 54496719) has the molecular formula C25H28ClNO6S2 and a molecular weight of 538.09 g/mol. Its IUPAC name is methyl 2-(2-chlorophenyl)-2-[3-(2-ethoxy-2-oxoethylidene)-4-(4-methylphenyl)sulfonylsulfanylpiperidin-1-yl]acetate.
| Compound Name | methyl 2-(2-chlorophenyl)-2-[3-(2-ethoxy-2-oxoethylidene)-4-(4-methylphenyl)sulfonylsulfanylpiperidin-1-yl]acetate |
|---|---|
| PubChem CID | 54496719 |
| Molecular Formula | C25H28ClNO6S2 |
| Molecular Weight | 538.09 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | methyl 2-(2-chlorophenyl)-2-[3-(2-ethoxy-2-oxoethylidene)-4-(4-methylphenyl)sulfonylsulfanylpiperidin-1-yl]acetate |
| SMILES | CCOC(=O)C=C1CN(C(C(=O)OC)c2ccccc2Cl)CCC1SS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H28ClNO6S2/c1-4-33-23(28)15-18-16-27(24(25(29)32-3)20-7-5-6-8-21(20)26)14-13-22(18)34-35(30,31)19-11-9-17(2)10-12-19/h5-12,15,22,24H,4,13-14,16H2,1-3H3 |
| InChIKey | XZPRLCRUBAAKIG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.09 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|