C16H18ClNO7S2 — CID 71497118
methyl (2S)-2-[(7aS)-2-oxo-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-5-yl]-2-(2-chlorophenyl)acetate;sulfuric acid (PubChem CID 71497118) has the molecular formula C16H18ClNO7S2 and a molecular weight of 435.91 g/mol. Its IUPAC name is methyl (2S)-2-[(7aS)-2-oxo-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-5-yl]-2-(2-chlorophenyl)acetate;sulfuric acid.
| Compound Name | methyl (2S)-2-[(7aS)-2-oxo-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-5-yl]-2-(2-chlorophenyl)acetate;sulfuric acid |
|---|---|
| PubChem CID | 71497118 |
| Molecular Formula | C16H18ClNO7S2 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | methyl (2S)-2-[(7aS)-2-oxo-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-5-yl]-2-(2-chlorophenyl)acetate;sulfuric acid |
| SMILES | COC(=O)[C@H](c1ccccc1Cl)N1CC[C@@H]2SC(=O)C=C2C1.O=S(=O)(O)O |
| InChI | InChI=1S/C16H16ClNO3S.H2O4S/c1-21-16(20)15(11-4-2-3-5-12(11)17)18-7-6-13-10(9-18)8-14(19)22-13;1-5(2,3)4/h2-5,8,13,15H,6-7,9H2,1H3;(H2,1,2,3,4)/t13-,15-;/m0./s1 |
| InChIKey | UNHVSUGSGIXYQF-SLHAJLBXSA-N |
| XLogP | 2.18 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|