C18H19ClFNO2S — CID 89186733
5-[5-chloro-1-(2-fluorophenyl)-2-oxopentyl]-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one (PubChem CID 89186733) has the molecular formula C18H19ClFNO2S and a molecular weight of 367.87 g/mol. Its IUPAC name is 5-[5-chloro-1-(2-fluorophenyl)-2-oxopentyl]-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one.
| Compound Name | 5-[5-chloro-1-(2-fluorophenyl)-2-oxopentyl]-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 89186733 |
| Molecular Formula | C18H19ClFNO2S |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 5-[5-chloro-1-(2-fluorophenyl)-2-oxopentyl]-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one |
| SMILES | O=C1C=C2CN(C(C(=O)CCCCl)c3ccccc3F)CCC2S1 |
| InChI | InChI=1S/C18H19ClFNO2S/c19-8-3-6-15(22)18(13-4-1-2-5-14(13)20)21-9-7-16-12(11-21)10-17(23)24-16/h1-2,4-5,10,16,18H,3,6-9,11H2 |
| InChIKey | XBQGXCKLRYWNKT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|