C38H40Cl2N2O10S2 — CID 159735645
acetyl acetate;methyl 2-(2-acetyloxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-(2-chlorophenyl)acetate;methyl 2-(2-chlorophenyl)-2-(2-oxo-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-5-yl)acetate (PubChem CID 159735645) has the molecular formula C38H40Cl2N2O10S2 and a molecular weight of 819.78 g/mol. Its IUPAC name is acetyl acetate;methyl 2-(2-acetyloxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-(2-chlorophenyl)acetate;methyl 2-(2-chlorophenyl)-2-(2-oxo-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-5-yl)acetate.
| Compound Name | acetyl acetate;methyl 2-(2-acetyloxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-(2-chlorophenyl)acetate;methyl 2-(2-chlorophenyl)-2-(2-oxo-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-5-yl)acetate |
|---|---|
| PubChem CID | 159735645 |
| Molecular Formula | C38H40Cl2N2O10S2 |
| Molecular Weight | 819.78 g/mol |
| Exact Mass | 818.15 |
| IUPAC Name | acetyl acetate;methyl 2-(2-acetyloxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-(2-chlorophenyl)acetate;methyl 2-(2-chlorophenyl)-2-(2-oxo-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-5-yl)acetate |
| SMILES | CC(=O)OC(C)=O.COC(=O)C(c1ccccc1Cl)N1CCC2SC(=O)C=C2C1.COC(=O)C(c1ccccc1Cl)N1CCc2sc(OC(C)=O)cc2C1 |
| InChI | InChI=1S/C18H18ClNO4S.C16H16ClNO3S.C4H6O3/c1-11(21)24-16-9-12-10-20(8-7-15(12)25-16)17(18(22)23-2)13-5-3-4-6-14(13)19;1-21-16(20)15(11-4-2-3-5-12(11)17)18-7-6-13-10(9-18)8-14(19)22-13;1-3(5)7-4(2)6/h3-6,9,17H,7-8,10H2,1-2H3;2-5,8,13,15H,6-7,9H2,1H3;1-2H3 |
| InChIKey | NBUMWCAUGBMZND-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.78 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|