C23H28FN5O3S — CID 87565611
5-[5-[(Z)-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]tetrazol-1-yl]pentanoic acid (PubChem CID 87565611) has the molecular formula C23H28FN5O3S and a molecular weight of 473.57 g/mol. Its IUPAC name is 5-[5-[(Z)-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]tetrazol-1-yl]pentanoic acid.
| Compound Name | 5-[5-[(Z)-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]tetrazol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 87565611 |
| Molecular Formula | C23H28FN5O3S |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 5-[5-[(Z)-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]tetrazol-1-yl]pentanoic acid |
| SMILES | O=C(O)CCCCn1nnnc1/C=C1/CN(C(C(=O)C2CC2)c2ccccc2F)CCC1S |
| InChI | InChI=1S/C23H28FN5O3S/c24-18-6-2-1-5-17(18)22(23(32)15-8-9-15)28-12-10-19(33)16(14-28)13-20-25-26-27-29(20)11-4-3-7-21(30)31/h1-2,5-6,13,15,19,22,33H,3-4,7-12,14H2,(H,30,31)/b16-13- |
| InChIKey | PYGNXBCICVOEAF-SSZFMOIBSA-N |
| XLogP | 3.17 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|