C25H32FN5O3S — CID 74020419
5-[5-[[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]triazol-1-yl]-N-methoxypentanamide (PubChem CID 74020419) has the molecular formula C25H32FN5O3S and a molecular weight of 501.63 g/mol. Its IUPAC name is 5-[5-[[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]triazol-1-yl]-N-methoxypentanamide.
| Compound Name | 5-[5-[[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]triazol-1-yl]-N-methoxypentanamide |
|---|---|
| PubChem CID | 74020419 |
| Molecular Formula | C25H32FN5O3S |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 5-[5-[[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]triazol-1-yl]-N-methoxypentanamide |
| SMILES | CONC(=O)CCCCn1nncc1C=C1CN(C(C(=O)C2CC2)c2ccccc2F)CCC1S |
| InChI | InChI=1S/C25H32FN5O3S/c1-34-28-23(32)8-4-5-12-31-19(15-27-29-31)14-18-16-30(13-11-22(18)35)24(25(33)17-9-10-17)20-6-2-3-7-21(20)26/h2-3,6-7,14-15,17,22,24,35H,4-5,8-13,16H2,1H3,(H,28,32) |
| InChIKey | QKIHVRPLCLDTJJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|