C23H27FN4O3S — CID 91298167
ethyl 3-[2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]triazole-4-carboxylate (PubChem CID 91298167) has the molecular formula C23H27FN4O3S and a molecular weight of 458.56 g/mol. Its IUPAC name is ethyl 3-[2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]triazole-4-carboxylate.
| Compound Name | ethyl 3-[2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 91298167 |
| Molecular Formula | C23H27FN4O3S |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | ethyl 3-[2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnnn1CC=C1CN(C(C(=O)C2CC2)c2ccccc2F)CCC1S |
| InChI | InChI=1S/C23H27FN4O3S/c1-2-31-23(30)19-13-25-26-28(19)12-9-16-14-27(11-10-20(16)32)21(22(29)15-7-8-15)17-5-3-4-6-18(17)24/h3-6,9,13,15,20-21,32H,2,7-8,10-12,14H2,1H3 |
| InChIKey | KRLKMMYWYQQDRC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 77.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|