C19H24FNO2S — CID 58000414
1-cyclopropyl-2-(2-fluorophenyl)-2-[(3E)-3-(2-methoxyethylidene)-4-sulfanylpiperidin-1-yl]ethanone (PubChem CID 58000414) has the molecular formula C19H24FNO2S and a molecular weight of 349.47 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2-fluorophenyl)-2-[(3E)-3-(2-methoxyethylidene)-4-sulfanylpiperidin-1-yl]ethanone.
| Compound Name | 1-cyclopropyl-2-(2-fluorophenyl)-2-[(3E)-3-(2-methoxyethylidene)-4-sulfanylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 58000414 |
| Molecular Formula | C19H24FNO2S |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 1-cyclopropyl-2-(2-fluorophenyl)-2-[(3E)-3-(2-methoxyethylidene)-4-sulfanylpiperidin-1-yl]ethanone |
| SMILES | COC/C=C1\CN(C(C(=O)C2CC2)c2ccccc2F)CCC1S |
| InChI | InChI=1S/C19H24FNO2S/c1-23-11-9-14-12-21(10-8-17(14)24)18(19(22)13-6-7-13)15-4-2-3-5-16(15)20/h2-5,9,13,17-18,24H,6-8,10-12H2,1H3/b14-9+ |
| InChIKey | YKACCEXZNANUSF-NTEUORMPSA-N |
| XLogP | 3.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|