C21H26FNO3S — CID 89125671
1-cyclopropyl-2-(2-fluorophenyl)-2-[(3E)-3-[2-(4-methyl-1,3-dioxetan-2-yl)ethylidene]-4-sulfanylpiperidin-1-yl]ethanone (PubChem CID 89125671) has the molecular formula C21H26FNO3S and a molecular weight of 391.51 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2-fluorophenyl)-2-[(3E)-3-[2-(4-methyl-1,3-dioxetan-2-yl)ethylidene]-4-sulfanylpiperidin-1-yl]ethanone.
| Compound Name | 1-cyclopropyl-2-(2-fluorophenyl)-2-[(3E)-3-[2-(4-methyl-1,3-dioxetan-2-yl)ethylidene]-4-sulfanylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 89125671 |
| Molecular Formula | C21H26FNO3S |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-cyclopropyl-2-(2-fluorophenyl)-2-[(3E)-3-[2-(4-methyl-1,3-dioxetan-2-yl)ethylidene]-4-sulfanylpiperidin-1-yl]ethanone |
| SMILES | CC1OC(C/C=C2\CN(C(C(=O)C3CC3)c3ccccc3F)CCC2S)O1 |
| InChI | InChI=1S/C21H26FNO3S/c1-13-25-19(26-13)9-8-15-12-23(11-10-18(15)27)20(21(24)14-6-7-14)16-4-2-3-5-17(16)22/h2-5,8,13-14,18-20,27H,6-7,9-12H2,1H3/b15-8+ |
| InChIKey | GTKZTTKKZSIWQV-OVCLIPMQSA-N |
| XLogP | 3.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|