C21H27ClFNO3S — CID 87661970
ethyl (3Z)-3-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]propanoate;hydrochloride (PubChem CID 87661970) has the molecular formula C21H27ClFNO3S and a molecular weight of 427.97 g/mol. Its IUPAC name is ethyl (3Z)-3-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]propanoate;hydrochloride.
| Compound Name | ethyl (3Z)-3-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]propanoate;hydrochloride |
|---|---|
| PubChem CID | 87661970 |
| Molecular Formula | C21H27ClFNO3S |
| Molecular Weight | 427.97 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | ethyl (3Z)-3-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]propanoate;hydrochloride |
| SMILES | CCOC(=O)C/C=C1/CN(C(C(=O)C2CC2)c2ccccc2F)CCC1S.Cl |
| InChI | InChI=1S/C21H26FNO3S.ClH/c1-2-26-19(24)10-9-15-13-23(12-11-18(15)27)20(21(25)14-7-8-14)16-5-3-4-6-17(16)22;/h3-6,9,14,18,20,27H,2,7-8,10-13H2,1H3;1H/b15-9-; |
| InChIKey | JHDLIYGMPARVPK-SOCRLDLMSA-N |
| XLogP | 4.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.97 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|