C26H35FN2O3S — CID 87661947
ethyl 2-[4-[(Z)-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]piperidin-1-yl]acetate (PubChem CID 87661947) has the molecular formula C26H35FN2O3S and a molecular weight of 474.64 g/mol. Its IUPAC name is ethyl 2-[4-[(Z)-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]piperidin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[(Z)-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 87661947 |
| Molecular Formula | C26H35FN2O3S |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | ethyl 2-[4-[(Z)-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]piperidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCC(/C=C2/CN(C(C(=O)C3CC3)c3ccccc3F)CCC2S)CC1 |
| InChI | InChI=1S/C26H35FN2O3S/c1-2-32-24(30)17-28-12-9-18(10-13-28)15-20-16-29(14-11-23(20)33)25(26(31)19-7-8-19)21-5-3-4-6-22(21)27/h3-6,15,18-19,23,25,33H,2,7-14,16-17H2,1H3/b20-15- |
| InChIKey | WSMLDJNGBFHRQM-HKWRFOASSA-N |
| XLogP | 4.05 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|