C28H37FN2O4S — CID 58000365
ethyl 2-[4-[(E)-[4-acetylsulfanyl-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]piperidin-3-ylidene]methyl]piperidin-1-yl]acetate (PubChem CID 58000365) has the molecular formula C28H37FN2O4S and a molecular weight of 516.68 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-[4-acetylsulfanyl-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]piperidin-3-ylidene]methyl]piperidin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[(E)-[4-acetylsulfanyl-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]piperidin-3-ylidene]methyl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 58000365 |
| Molecular Formula | C28H37FN2O4S |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | ethyl 2-[4-[(E)-[4-acetylsulfanyl-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]piperidin-3-ylidene]methyl]piperidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCC(/C=C2\CN(C(C(=O)C3CC3)c3ccccc3F)CCC2SC(C)=O)CC1 |
| InChI | InChI=1S/C28H37FN2O4S/c1-3-35-26(33)18-30-13-10-20(11-14-30)16-22-17-31(15-12-25(22)36-19(2)32)27(28(34)21-8-9-21)23-6-4-5-7-24(23)29/h4-7,16,20-21,25,27H,3,8-15,17-18H2,1-2H3/b22-16+ |
| InChIKey | QMLVCILAXHHMDU-CJLVFECKSA-N |
| XLogP | 4.40 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|