C26H34FN3O4S — CID 90703375
ethyl 2-[4-[2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]-2-oxopiperazin-1-yl]acetate (PubChem CID 90703375) has the molecular formula C26H34FN3O4S and a molecular weight of 503.64 g/mol. Its IUPAC name is ethyl 2-[4-[2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]-2-oxopiperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]-2-oxopiperazin-1-yl]acetate |
|---|---|
| PubChem CID | 90703375 |
| Molecular Formula | C26H34FN3O4S |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | ethyl 2-[4-[2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]-2-oxopiperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(CC=C2CN(C(C(=O)C3CC3)c3ccccc3F)CCC2S)CC1=O |
| InChI | InChI=1S/C26H34FN3O4S/c1-2-34-24(32)17-29-14-13-28(16-23(29)31)11-9-19-15-30(12-10-22(19)35)25(26(33)18-7-8-18)20-5-3-4-6-21(20)27/h3-6,9,18,22,25,35H,2,7-8,10-17H2,1H3 |
| InChIKey | JZTAFZPGYLVINH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|