C25H35FN2O3S — CID 91275518
ethyl 2-[2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl-propan-2-ylamino]acetate (PubChem CID 91275518) has the molecular formula C25H35FN2O3S and a molecular weight of 462.63 g/mol. Its IUPAC name is ethyl 2-[2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl-propan-2-ylamino]acetate.
| Compound Name | ethyl 2-[2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl-propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 91275518 |
| Molecular Formula | C25H35FN2O3S |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | ethyl 2-[2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl-propan-2-ylamino]acetate |
| SMILES | CCOC(=O)CN(CC=C1CN(C(C(=O)C2CC2)c2ccccc2F)CCC1S)C(C)C |
| InChI | InChI=1S/C25H35FN2O3S/c1-4-31-23(29)16-27(17(2)3)13-11-19-15-28(14-12-22(19)32)24(25(30)18-9-10-18)20-7-5-6-8-21(20)26/h5-8,11,17-18,22,24,32H,4,9-10,12-16H2,1-3H3 |
| InChIKey | LEJKACILFBIEIV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|