C19H23ClFNO3S — CID 87662362
(3E)-3-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]propanoic acid;hydrochloride (PubChem CID 87662362) has the molecular formula C19H23ClFNO3S and a molecular weight of 399.92 g/mol. Its IUPAC name is (3E)-3-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]propanoic acid;hydrochloride.
| Compound Name | (3E)-3-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 87662362 |
| Molecular Formula | C19H23ClFNO3S |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (3E)-3-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]propanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)C/C=C1\CN(C(C(=O)C2CC2)c2ccccc2F)CCC1S |
| InChI | InChI=1S/C19H22FNO3S.ClH/c20-15-4-2-1-3-14(15)18(19(24)12-5-6-12)21-10-9-16(25)13(11-21)7-8-17(22)23;/h1-4,7,12,16,18,25H,5-6,8-11H2,(H,22,23);1H/b13-7+; |
| InChIKey | SOOGFCPUDJKBBZ-FTPOTTDRSA-N |
| XLogP | 3.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|