C23H26FN3O3S — CID 140543948
1-[(3E)-3-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]propyl]pyrazole-4-carboxylic acid (PubChem CID 140543948) has the molecular formula C23H26FN3O3S and a molecular weight of 443.54 g/mol. Its IUPAC name is 1-[(3E)-3-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]propyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[(3E)-3-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]propyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 140543948 |
| Molecular Formula | C23H26FN3O3S |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 1-[(3E)-3-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]propyl]pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnn(CC/C=C2\CN(C(C(=O)C3CC3)c3ccccc3F)CCC2S)c1 |
| InChI | InChI=1S/C23H26FN3O3S/c24-19-6-2-1-5-18(19)21(22(28)15-7-8-15)26-11-9-20(31)16(13-26)4-3-10-27-14-17(12-25-27)23(29)30/h1-2,4-6,12,14-15,20-21,31H,3,7-11,13H2,(H,29,30)/b16-4+ |
| InChIKey | VVUUSVKGQAKWAD-AYSLTRBKSA-N |
| XLogP | 3.76 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|