C24H28FN3O3S — CID 87661813
ethyl 1-[(2Z)-2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]pyrazole-4-carboxylate (PubChem CID 87661813) has the molecular formula C24H28FN3O3S and a molecular weight of 457.57 g/mol. Its IUPAC name is ethyl 1-[(2Z)-2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[(2Z)-2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 87661813 |
| Molecular Formula | C24H28FN3O3S |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | ethyl 1-[(2Z)-2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C/C=C2/CN(C(C(=O)C3CC3)c3ccccc3F)CCC2S)c1 |
| InChI | InChI=1S/C24H28FN3O3S/c1-2-31-24(30)18-13-26-28(15-18)12-9-17-14-27(11-10-21(17)32)22(23(29)16-7-8-16)19-5-3-4-6-20(19)25/h3-6,9,13,15-16,21-22,32H,2,7-8,10-12,14H2,1H3/b17-9- |
| InChIKey | TUUDZFIKIRZTSH-MFOYZWKCSA-N |
| XLogP | 3.85 |
| TPSA | 64.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|