C22H24FN3O3S — CID 58000343
1-[(2Z)-2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]pyrazole-4-carboxylic acid (PubChem CID 58000343) has the molecular formula C22H24FN3O3S and a molecular weight of 429.52 g/mol. Its IUPAC name is 1-[(2Z)-2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[(2Z)-2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 58000343 |
| Molecular Formula | C22H24FN3O3S |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 1-[(2Z)-2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnn(C/C=C2/CN(C(C(=O)C3CC3)c3ccccc3F)CCC2S)c1 |
| InChI | InChI=1S/C22H24FN3O3S/c23-18-4-2-1-3-17(18)20(21(27)14-5-6-14)25-9-8-19(30)15(12-25)7-10-26-13-16(11-24-26)22(28)29/h1-4,7,11,13-14,19-20,30H,5-6,8-10,12H2,(H,28,29)/b15-7- |
| InChIKey | IAQIBVQSWOWXLL-CHHVJCJISA-N |
| XLogP | 3.37 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|