C24H31FN2O3S — CID 58000395
2-[4-[(E)-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]piperidin-1-yl]acetic acid (PubChem CID 58000395) has the molecular formula C24H31FN2O3S and a molecular weight of 446.59 g/mol. Its IUPAC name is 2-[4-[(E)-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[(E)-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 58000395 |
| Molecular Formula | C24H31FN2O3S |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 2-[4-[(E)-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]piperidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCC(/C=C2\CN(C(C(=O)C3CC3)c3ccccc3F)CCC2S)CC1 |
| InChI | InChI=1S/C24H31FN2O3S/c25-20-4-2-1-3-19(20)23(24(30)17-5-6-17)27-12-9-21(31)18(14-27)13-16-7-10-26(11-8-16)15-22(28)29/h1-4,13,16-17,21,23,31H,5-12,14-15H2,(H,28,29)/b18-13+ |
| InChIKey | WNVZRPXDGRJQRC-QGOAFFKASA-N |
| XLogP | 3.57 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|