C25H32FN3O4S — CID 173130497
2-[4-[2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]-2-oxopiperazin-1-yl]propanoic acid (PubChem CID 173130497) has the molecular formula C25H32FN3O4S and a molecular weight of 489.61 g/mol. Its IUPAC name is 2-[4-[2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]-2-oxopiperazin-1-yl]propanoic acid.
| Compound Name | 2-[4-[2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]-2-oxopiperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 173130497 |
| Molecular Formula | C25H32FN3O4S |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 2-[4-[2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]ethyl]-2-oxopiperazin-1-yl]propanoic acid |
| SMILES | CC(C(=O)O)N1CCN(CC=C2CN(C(C(=O)C3CC3)c3ccccc3F)CCC2S)CC1=O |
| InChI | InChI=1S/C25H32FN3O4S/c1-16(25(32)33)29-13-12-27(15-22(29)30)10-8-18-14-28(11-9-21(18)34)23(24(31)17-6-7-17)19-4-2-3-5-20(19)26/h2-5,8,16-17,21,23,34H,6-7,9-15H2,1H3,(H,32,33) |
| InChIKey | QTLKYNDMCILJGH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|