C26H32FN3O5S — CID 74375620
2-[4-[2-[4-acetylsulfanyl-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]piperidin-3-ylidene]ethyl]-2-oxopiperazin-1-yl]acetic acid (PubChem CID 74375620) has the molecular formula C26H32FN3O5S and a molecular weight of 517.62 g/mol. Its IUPAC name is 2-[4-[2-[4-acetylsulfanyl-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]piperidin-3-ylidene]ethyl]-2-oxopiperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[4-acetylsulfanyl-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]piperidin-3-ylidene]ethyl]-2-oxopiperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 74375620 |
| Molecular Formula | C26H32FN3O5S |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 2-[4-[2-[4-acetylsulfanyl-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]piperidin-3-ylidene]ethyl]-2-oxopiperazin-1-yl]acetic acid |
| SMILES | CC(=O)SC1CCN(C(C(=O)C2CC2)c2ccccc2F)CC1=CCN1CCN(CC(=O)O)C(=O)C1 |
| InChI | InChI=1S/C26H32FN3O5S/c1-17(31)36-22-9-11-30(25(26(35)18-6-7-18)20-4-2-3-5-21(20)27)14-19(22)8-10-28-12-13-29(16-24(33)34)23(32)15-28/h2-5,8,18,22,25H,6-7,9-16H2,1H3,(H,33,34) |
| InChIKey | PFXIISIWEMGRHX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|