C20H24FNO3S — CID 87662099
S-[(3E,4R)-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-3-(2-hydroxyethylidene)piperidin-4-yl] ethanethioate (PubChem CID 87662099) has the molecular formula C20H24FNO3S and a molecular weight of 377.48 g/mol. Its IUPAC name is S-[(3E,4R)-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-3-(2-hydroxyethylidene)piperidin-4-yl] ethanethioate.
| Compound Name | S-[(3E,4R)-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-3-(2-hydroxyethylidene)piperidin-4-yl] ethanethioate |
|---|---|
| PubChem CID | 87662099 |
| Molecular Formula | C20H24FNO3S |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | S-[(3E,4R)-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-3-(2-hydroxyethylidene)piperidin-4-yl] ethanethioate |
| SMILES | CC(=O)S[C@@H]1CCN(C(C(=O)C2CC2)c2ccccc2F)C/C1=C\CO |
| InChI | InChI=1S/C20H24FNO3S/c1-13(24)26-18-8-10-22(12-15(18)9-11-23)19(20(25)14-6-7-14)16-4-2-3-5-17(16)21/h2-5,9,14,18-19,23H,6-8,10-12H2,1H3/b15-9+/t18-,19?/m1/s1 |
| InChIKey | UMAZOVHIJALKRO-JQCCVBTOSA-N |
| XLogP | 3.12 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|