C25H33FN2O2S — CID 87662652
S-[(3Z)-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-3-(2-piperidin-1-ylethylidene)piperidin-4-yl] ethanethioate (PubChem CID 87662652) has the molecular formula C25H33FN2O2S and a molecular weight of 444.62 g/mol. Its IUPAC name is S-[(3Z)-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-3-(2-piperidin-1-ylethylidene)piperidin-4-yl] ethanethioate.
| Compound Name | S-[(3Z)-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-3-(2-piperidin-1-ylethylidene)piperidin-4-yl] ethanethioate |
|---|---|
| PubChem CID | 87662652 |
| Molecular Formula | C25H33FN2O2S |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | S-[(3Z)-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-3-(2-piperidin-1-ylethylidene)piperidin-4-yl] ethanethioate |
| SMILES | CC(=O)SC1CCN(C(C(=O)C2CC2)c2ccccc2F)C/C1=C/CN1CCCCC1 |
| InChI | InChI=1S/C25H33FN2O2S/c1-18(29)31-23-12-16-28(17-20(23)11-15-27-13-5-2-6-14-27)24(25(30)19-9-10-19)21-7-3-4-8-22(21)26/h3-4,7-8,11,19,23-24H,2,5-6,9-10,12-17H2,1H3/b20-11- |
| InChIKey | NILGUVSUBRUECE-JAIQZWGSSA-N |
| XLogP | 4.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|