C26H33FN4O3S — CID 87567530
ethyl 5-[5-[(Z)-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]triazol-1-yl]pentanoate (PubChem CID 87567530) has the molecular formula C26H33FN4O3S and a molecular weight of 500.64 g/mol. Its IUPAC name is ethyl 5-[5-[(Z)-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]triazol-1-yl]pentanoate.
| Compound Name | ethyl 5-[5-[(Z)-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]triazol-1-yl]pentanoate |
|---|---|
| PubChem CID | 87567530 |
| Molecular Formula | C26H33FN4O3S |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | ethyl 5-[5-[(Z)-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-sulfanylpiperidin-3-ylidene]methyl]triazol-1-yl]pentanoate |
| SMILES | CCOC(=O)CCCCn1nncc1/C=C1/CN(C(C(=O)C2CC2)c2ccccc2F)CCC1S |
| InChI | InChI=1S/C26H33FN4O3S/c1-2-34-24(32)9-5-6-13-31-20(16-28-29-31)15-19-17-30(14-12-23(19)35)25(26(33)18-10-11-18)21-7-3-4-8-22(21)27/h3-4,7-8,15-16,18,23,25,35H,2,5-6,9-14,17H2,1H3/b19-15- |
| InChIKey | FAPDBOBTESUJHW-CYVLTUHYSA-N |
| XLogP | 4.26 |
| TPSA | 77.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|