C15H18ClNO2S — CID 138713974
methyl (2S)-2-(2-chlorophenyl)-2-(5-methyl-4-sulfanyl-3,6-dihydro-2H-pyridin-1-yl)acetate (PubChem CID 138713974) has the molecular formula C15H18ClNO2S and a molecular weight of 311.83 g/mol. Its IUPAC name is methyl (2S)-2-(2-chlorophenyl)-2-(5-methyl-4-sulfanyl-3,6-dihydro-2H-pyridin-1-yl)acetate.
| Compound Name | methyl (2S)-2-(2-chlorophenyl)-2-(5-methyl-4-sulfanyl-3,6-dihydro-2H-pyridin-1-yl)acetate |
|---|---|
| PubChem CID | 138713974 |
| Molecular Formula | C15H18ClNO2S |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | methyl (2S)-2-(2-chlorophenyl)-2-(5-methyl-4-sulfanyl-3,6-dihydro-2H-pyridin-1-yl)acetate |
| SMILES | COC(=O)[C@H](c1ccccc1Cl)N1CCC(S)=C(C)C1 |
| InChI | InChI=1S/C15H18ClNO2S/c1-10-9-17(8-7-13(10)20)14(15(18)19-2)11-5-3-4-6-12(11)16/h3-6,14,20H,7-9H2,1-2H3/t14-/m0/s1 |
| InChIKey | RNUNHOUOMAOVQM-AWEZNQCLSA-N |
| XLogP | 3.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|