C16H18ClNO5S — CID 158850021
methyl (2S)-2-(2-chlorophenyl)-2-(5-ethoxycarbonyloxy-4-sulfanyl-2,3-dihydropyrrol-1-yl)acetate (PubChem CID 158850021) has the molecular formula C16H18ClNO5S and a molecular weight of 371.84 g/mol. Its IUPAC name is methyl (2S)-2-(2-chlorophenyl)-2-(5-ethoxycarbonyloxy-4-sulfanyl-2,3-dihydropyrrol-1-yl)acetate.
| Compound Name | methyl (2S)-2-(2-chlorophenyl)-2-(5-ethoxycarbonyloxy-4-sulfanyl-2,3-dihydropyrrol-1-yl)acetate |
|---|---|
| PubChem CID | 158850021 |
| Molecular Formula | C16H18ClNO5S |
| Molecular Weight | 371.84 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | methyl (2S)-2-(2-chlorophenyl)-2-(5-ethoxycarbonyloxy-4-sulfanyl-2,3-dihydropyrrol-1-yl)acetate |
| SMILES | CCOC(=O)OC1=C(S)CCN1[C@H](C(=O)OC)c1ccccc1Cl |
| InChI | InChI=1S/C16H18ClNO5S/c1-3-22-16(20)23-14-12(24)8-9-18(14)13(15(19)21-2)10-6-4-5-7-11(10)17/h4-7,13,24H,3,8-9H2,1-2H3/t13-/m0/s1 |
| InChIKey | IZIFSXCFYYLNIR-ZDUSSCGKSA-N |
| XLogP | 3.53 |
| TPSA | 65.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.84 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|