C16H16ClNO6PS-3 — CID 66547197
methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate phosphate (PubChem CID 66547197) has the molecular formula C16H16ClNO6PS-3 and a molecular weight of 416.80 g/mol. Its IUPAC name is methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate phosphate.
| Compound Name | methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate phosphate |
|---|---|
| PubChem CID | 66547197 |
| Molecular Formula | C16H16ClNO6PS-3 |
| Molecular Weight | 416.80 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate phosphate |
| SMILES | COC(=O)[C@H](c1ccccc1Cl)N1CCc2sccc2C1.O=P([O-])([O-])[O-] |
| InChI | InChI=1S/C16H16ClNO2S.H3O4P/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14;1-5(2,3)4/h2-5,7,9,15H,6,8,10H2,1H3;(H3,1,2,3,4)/p-3/t15-;/m0./s1 |
| InChIKey | AOLIEMSYHKWOKC-RSAXXLAASA-K |
| XLogP | 0.85 |
| TPSA | 115.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.80 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|