C26H30ClNO7S2 — CID 87986731
benzenesulfonic acid;1,4-dioxane;methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate (PubChem CID 87986731) has the molecular formula C26H30ClNO7S2 and a molecular weight of 568.11 g/mol. Its IUPAC name is benzenesulfonic acid;1,4-dioxane;methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate.
| Compound Name | benzenesulfonic acid;1,4-dioxane;methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate |
|---|---|
| PubChem CID | 87986731 |
| Molecular Formula | C26H30ClNO7S2 |
| Molecular Weight | 568.11 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | benzenesulfonic acid;1,4-dioxane;methyl (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate |
| SMILES | C1COCCO1.COC(=O)[C@H](c1ccccc1Cl)N1CCc2sccc2C1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C16H16ClNO2S.C6H6O3S.C4H8O2/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14;7-10(8,9)6-4-2-1-3-5-6;1-2-6-4-3-5-1/h2-5,7,9,15H,6,8,10H2,1H3;1-5H,(H,7,8,9);1-4H2/t15-;;/m0../s1 |
| InChIKey | GRZYVMZCHXKIMU-CKUXDGONSA-N |
| XLogP | 4.64 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.11 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|